About 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine
2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine (PubChem CID 768630) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine |
| PubChem CID | 768630 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine |
| SMILES | CC1=CC(c2ccccc2)=Nc2ccc(C)cc2N1 |
| InChI | InChI=1S/C17H16N2/c1-12-8-9-15-17(10-12)18-13(2)11-16(19-15)14-6-4-3-5-7-14/h3-11,18H,1-2H3 |
| InChIKey | XNGGBOVUGMQDFI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine?
The IUPAC name of 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine (CID 768630) is 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine.
What is the SMILES notation for 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine?
The canonical SMILES for 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine is CC1=CC(c2ccccc2)=Nc2ccc(C)cc2N1.
What is the InChIKey of 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine?
The InChIKey is XNGGBOVUGMQDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2/c1-12-8-9-15-17(10-12)18-13(2)11-16(19-15)14-6-4-3-5-7-14/h3-11,18H,1-2H3.
What are the key properties of 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine?
2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine has a molecular weight of 248.33 g/mol, XLogP of 4.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-4-phenyl-1H-1,5-benzodiazepine is sourced from PubChem (CID 768630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).