C19H19ClN4O3S — CID 76863470
N-[2-(benzylsulfamoyl)ethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enamide (PubChem CID 76863470) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76863470 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1c(Cl)nc2ccccn12)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H19ClN4O3S/c20-19-16(24-12-5-4-8-17(24)23-19)9-10-18(25)21-11-13-28(26,27)22-14-15-6-2-1-3-7-15/h1-10,12,22H,11,13-14H2,(H,21,25) |
| InChIKey | JMZPIOKTBMRJJJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|