About 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid
9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid (PubChem CID 768661) has the molecular formula C15H15NO3
and a molecular weight of 257.29 g/mol. Its IUPAC name is 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid |
| PubChem CID | 768661 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid |
| SMILES | CCn1c2c(c3cc(C(=O)O)ccc31)CCCC2=O |
| InChI | InChI=1S/C15H15NO3/c1-2-16-12-7-6-9(15(18)19)8-11(12)10-4-3-5-13(17)14(10)16/h6-8H,2-5H2,1H3,(H,18,19) |
| InChIKey | NRVYAFJBOIBMBC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid?
The IUPAC name of 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid (CID 768661) is 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid.
What is the SMILES notation for 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid?
The canonical SMILES for 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid is CCn1c2c(c3cc(C(=O)O)ccc31)CCCC2=O.
What is the InChIKey of 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid?
The InChIKey is NRVYAFJBOIBMBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3/c1-2-16-12-7-6-9(15(18)19)8-11(12)10-4-3-5-13(17)14(10)16/h6-8H,2-5H2,1H3,(H,18,19).
What are the key properties of 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid?
9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid has a molecular weight of 257.29 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-8-oxo-6,7-dihydro-5H-carbazole-3-carboxylic acid is sourced from PubChem (CID 768661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).