C16H14F2N2O2 — CID 76869001
1-(2,4-difluorophenyl)-3-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 76869001) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 76869001 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C16H14F2N2O2/c17-10-5-6-13(12(18)8-10)19-16(22)20-15-11-4-2-1-3-9(11)7-14(15)21/h1-6,8,14-15,21H,7H2,(H2,19,20,22) |
| InChIKey | UDMWOQUMBPBIGG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |