C19H20N4O2S2 — CID 76869139
N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide (PubChem CID 76869139) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 76869139 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide |
| SMILES | Cn1c(=NNC(=O)C2CCCN2C(=O)Cc2cccs2)sc2ccccc21 |
| InChI | InChI=1S/C19H20N4O2S2/c1-22-14-7-2-3-9-16(14)27-19(22)21-20-18(25)15-8-4-10-23(15)17(24)12-13-6-5-11-26-13/h2-3,5-7,9,11,15H,4,8,10,12H2,1H3,(H,20,25) |
| InChIKey | LAPWDJDOZNKKQK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|