About 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide
2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide (PubChem CID 76870629) has the molecular formula C17H16ClN3O2
and a molecular weight of 329.79 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide |
| PubChem CID | 76870629 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide |
| SMILES | N#Cc1ccc(OCCON=C(N)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-16-4-2-1-3-14(16)11-17(20)21-23-10-9-22-15-7-5-13(12-19)6-8-15/h1-8H,9-11H2,(H2,20,21) |
| InChIKey | BNKGDKGCOFDTEP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide?
The IUPAC name of 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide (CID 76870629) is 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide.
What is the SMILES notation for 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide?
The canonical SMILES for 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide is N#Cc1ccc(OCCON=C(N)Cc2ccccc2Cl)cc1.
What is the InChIKey of 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide?
The InChIKey is BNKGDKGCOFDTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O2/c18-16-4-2-1-3-14(16)11-17(20)21-23-10-9-22-15-7-5-13(12-19)6-8-15/h1-8H,9-11H2,(H2,20,21).
What are the key properties of 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide?
2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide has a molecular weight of 329.79 g/mol, XLogP of 3.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-N'-[2-(4-cyanophenoxy)ethoxy]ethanimidamide is sourced from PubChem (CID 76870629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).