C19H15F3O2 — CID 76871265
2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 76871265) has the molecular formula C19H15F3O2 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 76871265 |
| Molecular Formula | C19H15F3O2 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[[4-(2,2,2-trifluoroethoxy)phenyl]methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1C(=Cc2ccc(OCC(F)(F)F)cc2)CCc2ccccc21 |
| InChI | InChI=1S/C19H15F3O2/c20-19(21,22)12-24-16-9-5-13(6-10-16)11-15-8-7-14-3-1-2-4-17(14)18(15)23/h1-6,9-11H,7-8,12H2 |
| InChIKey | SWKYXSDDNNNMDN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|