C13H17NO2 — CID 76872157
3-(2-ethoxyphenyl)-N,N-dimethylprop-2-enamide (PubChem CID 76872157) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-N,N-dimethylprop-2-enamide.
| Compound Name | 3-(2-ethoxyphenyl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 76872157 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(2-ethoxyphenyl)-N,N-dimethylprop-2-enamide |
| SMILES | CCOc1ccccc1C=CC(=O)N(C)C |
| InChI | InChI=1S/C13H17NO2/c1-4-16-12-8-6-5-7-11(12)9-10-13(15)14(2)3/h5-10H,4H2,1-3H3 |
| InChIKey | HEHVZQQXYOJQGT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|