C14H17NO4 — CID 76873640
2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]oxyacetic acid (PubChem CID 76873640) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]oxyacetic acid.
| Compound Name | 2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]oxyacetic acid |
|---|---|
| PubChem CID | 76873640 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[3-(4-propan-2-ylphenyl)prop-2-enoylamino]oxyacetic acid |
| SMILES | CC(C)c1ccc(C=CC(=O)NOCC(=O)O)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-10(2)12-6-3-11(4-7-12)5-8-13(16)15-19-9-14(17)18/h3-8,10H,9H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | VQQCFWZVHSLDAD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|