C9H12N6S — CID 76874394
2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine (PubChem CID 76874394) has the molecular formula C9H12N6S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine.
| Compound Name | 2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 76874394 |
| Molecular Formula | C9H12N6S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine |
| SMILES | Cc1cn2c(C=NN=C(N)N)c(C)nc2s1 |
| InChI | InChI=1S/C9H12N6S/c1-5-4-15-7(3-12-14-8(10)11)6(2)13-9(15)16-5/h3-4H,1-2H3,(H4,10,11,14) |
| InChIKey | RPGLLRSCFBPLOD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|