C12H13BrN2O2 — CID 76875677
1-[(3-bromophenyl)methyl]-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 76875677) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(3-bromophenyl)methyl]-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 76875677 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1CN(Cc2cccc(Br)c2)C(=O)NC1=O |
| InChI | InChI=1S/C12H13BrN2O2/c1-8-6-15(12(17)14-11(8)16)7-9-3-2-4-10(13)5-9/h2-5,8H,6-7H2,1H3,(H,14,16,17) |
| InChIKey | CPCKTEKPFZCYPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |