C17H24N2O2 — CID 76879325
N-[2-cyclopropyl-2-(hexa-2,4-dienoylamino)ethyl]hexa-2,4-dienamide (PubChem CID 76879325) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-(hexa-2,4-dienoylamino)ethyl]hexa-2,4-dienamide.
| Compound Name | N-[2-cyclopropyl-2-(hexa-2,4-dienoylamino)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 76879325 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[2-cyclopropyl-2-(hexa-2,4-dienoylamino)ethyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(NC(=O)C=CC=CC)C1CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-5-7-9-16(20)18-13-15(14-11-12-14)19-17(21)10-8-6-4-2/h3-10,14-15H,11-13H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | KPFXYGTURFEEBY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|