C23H31N3O3 — CID 7688372
N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 7688372) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 7688372 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(CC(=O)N[C@@H]1CCCc3ccccc31)C2=O |
| InChI | InChI=1S/C23H31N3O3/c1-15-11-22(2,3)14-23(12-15)20(28)26(21(29)25-23)13-19(27)24-18-10-6-8-16-7-4-5-9-17(16)18/h4-5,7,9,15,18H,6,8,10-14H2,1-3H3,(H,24,27)(H,25,29)/t15-,18+,23-/m0/s1 |
| InChIKey | WECXCKHTAAUJMS-HOSQHVHZSA-N |
| XLogP | 3.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|