C17H20N2O3S2 — CID 76885915
N-methyl-3-(2-methyl-1,3-thiazol-4-yl)-N-(2,4,6-trimethylphenyl)sulfonylprop-2-enamide (PubChem CID 76885915) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-methyl-3-(2-methyl-1,3-thiazol-4-yl)-N-(2,4,6-trimethylphenyl)sulfonylprop-2-enamide.
| Compound Name | N-methyl-3-(2-methyl-1,3-thiazol-4-yl)-N-(2,4,6-trimethylphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 76885915 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-methyl-3-(2-methyl-1,3-thiazol-4-yl)-N-(2,4,6-trimethylphenyl)sulfonylprop-2-enamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C)C(=O)C=Cc2csc(C)n2)c(C)c1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-11-8-12(2)17(13(3)9-11)24(21,22)19(5)16(20)7-6-15-10-23-14(4)18-15/h6-10H,1-5H3 |
| InChIKey | YKVVWESRLHOQNJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|