About 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione
5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione (PubChem CID 76886990) has the molecular formula C8H14N2O4S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione |
| PubChem CID | 76886990 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione |
| SMILES | CC1CN(CCS(C)(=O)=O)C(=O)NC1=O |
| InChI | InChI=1S/C8H14N2O4S/c1-6-5-10(3-4-15(2,13)14)8(12)9-7(6)11/h6H,3-5H2,1-2H3,(H,9,11,12) |
| InChIKey | XKYOSEVODUYPOT-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione?
The IUPAC name of 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione (CID 76886990) is 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione is CC1CN(CCS(C)(=O)=O)C(=O)NC1=O.
What is the InChIKey of 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione?
The InChIKey is XKYOSEVODUYPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4S/c1-6-5-10(3-4-15(2,13)14)8(12)9-7(6)11/h6H,3-5H2,1-2H3,(H,9,11,12).
What are the key properties of 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione?
5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione has a molecular weight of 234.28 g/mol, XLogP of -0.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4-dione is sourced from PubChem (CID 76886990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).