C7H9N3OS — CID 76889740
N'-hydroxy-2-methylsulfanylpyridine-3-carboximidamide (PubChem CID 76889740) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is N'-hydroxy-2-methylsulfanylpyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-methylsulfanylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 76889740 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | N'-hydroxy-2-methylsulfanylpyridine-3-carboximidamide |
| SMILES | CSc1ncccc1C(N)=NO |
| InChI | InChI=1S/C7H9N3OS/c1-12-7-5(6(8)10-11)3-2-4-9-7/h2-4,11H,1H3,(H2,8,10) |
| InChIKey | JGNWWBNEAGHCNP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|