C15H14ClFN2O2 — CID 76892216
2-amino-N-(2-chloro-4-fluorophenyl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 76892216) has the molecular formula C15H14ClFN2O2 and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-amino-N-(2-chloro-4-fluorophenyl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | 2-amino-N-(2-chloro-4-fluorophenyl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 76892216 |
| Molecular Formula | C15H14ClFN2O2 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-amino-N-(2-chloro-4-fluorophenyl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H14ClFN2O2/c16-12-8-10(17)3-6-14(12)19-15(21)13(18)7-9-1-4-11(20)5-2-9/h1-6,8,13,20H,7,18H2,(H,19,21) |
| InChIKey | YRFYUZYZMOUANJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |