C17H27N3O — CID 76892322
2-amino-1-(4-benzylpiperazin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 76892322) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-amino-1-(4-benzylpiperazin-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 2-amino-1-(4-benzylpiperazin-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 76892322 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-amino-1-(4-benzylpiperazin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)C(N)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H27N3O/c1-17(2,3)15(18)16(21)20-11-9-19(10-12-20)13-14-7-5-4-6-8-14/h4-8,15H,9-13,18H2,1-3H3 |
| InChIKey | DASBDMKQGUDYIV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |