C12H16N2O — CID 76893209
N-ethyl-N-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76893209) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-ethyl-N-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76893209 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-ethyl-N-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CCN(C)C(=O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C12H16N2O/c1-3-14(2)12(15)11-8-9-6-4-5-7-10(9)13-11/h4-7,11,13H,3,8H2,1-2H3 |
| InChIKey | OYXOWJBPVNYIBR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |