C36H35F6NO5 — CID 76900173
4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-methylbenzoic acid (PubChem CID 76900173) has the molecular formula C36H35F6NO5 and a molecular weight of 675.67 g/mol. Its IUPAC name is 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-methylbenzoic acid.
| Compound Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 76900173 |
| Molecular Formula | C36H35F6NO5 |
| Molecular Weight | 675.67 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-methylbenzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2C)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C36H35F6NO5/c1-19-12-22(32(44)45)6-8-27(19)21-7-9-30(47-5)29(15-21)28-10-11-34(3,4)17-24(28)18-43-20(2)31(48-33(43)46)23-13-25(35(37,38)39)16-26(14-23)36(40,41)42/h6-9,12-16,20,31H,10-11,17-18H2,1-5H3,(H,44,45)/t20-,31-/m0/s1 |
| InChIKey | SUSMOOSYGMJWFW-GEFUHLBYSA-N |
| XLogP | 9.95 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.67 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |