About N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide
N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide (PubChem CID 76900265) has the molecular formula C18H23NO6S
and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide |
| PubChem CID | 76900265 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide |
| SMILES | COc1ccc(C(NS(C)(=O)=O)c2cccc(OC)c2OC)cc1OC |
| InChI | InChI=1S/C18H23NO6S/c1-22-14-10-9-12(11-16(14)24-3)17(19-26(5,20)21)13-7-6-8-15(23-2)18(13)25-4/h6-11,17,19H,1-5H3 |
| InChIKey | QWPBUVPWNCKPPE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide?
The IUPAC name of N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide (CID 76900265) is N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide.
What is the SMILES notation for N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide?
The canonical SMILES for N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide is COc1ccc(C(NS(C)(=O)=O)c2cccc(OC)c2OC)cc1OC.
What is the InChIKey of N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide?
The InChIKey is QWPBUVPWNCKPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO6S/c1-22-14-10-9-12(11-16(14)24-3)17(19-26(5,20)21)13-7-6-8-15(23-2)18(13)25-4/h6-11,17,19H,1-5H3.
What are the key properties of N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide?
N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide has a molecular weight of 381.45 g/mol, XLogP of 2.36, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,3-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methyl]methanesulfonamide is sourced from PubChem (CID 76900265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).