C19H24O5 — CID 76900355
[(1S,4aS,5R,6R)-5-buta-1,3-dien-2-yl-1-(3-methylbut-2-enyl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-6-yl] acetate (PubChem CID 76900355) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(1S,4aS,5R,6R)-5-buta-1,3-dien-2-yl-1-(3-methylbut-2-enyl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-6-yl] acetate.
| Compound Name | [(1S,4aS,5R,6R)-5-buta-1,3-dien-2-yl-1-(3-methylbut-2-enyl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-6-yl] acetate |
|---|---|
| PubChem CID | 76900355 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [(1S,4aS,5R,6R)-5-buta-1,3-dien-2-yl-1-(3-methylbut-2-enyl)-3-oxo-4,4a,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-6-yl] acetate |
| SMILES | C=CC(=C)[C@@H]1[C@@H](OC(C)=O)OC=C2[C@H](CC=C(C)C)OC(=O)C[C@H]21 |
| InChI | InChI=1S/C19H24O5/c1-6-12(4)18-14-9-17(21)24-16(8-7-11(2)3)15(14)10-22-19(18)23-13(5)20/h6-7,10,14,16,18-19H,1,4,8-9H2,2-3,5H3/t14-,16+,18+,19-/m1/s1 |
| InChIKey | VJHRYODKPASJPU-TWKWOARYSA-N |
| XLogP | 3.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|