C24H24N8O2S — CID 76900494
4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 76900494) has the molecular formula C24H24N8O2S and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 76900494 |
| Molecular Formula | C24H24N8O2S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | Cc1nsc(NC(=O)c2ccc(-c3nc([C@@H]4CC[C@H]5CCC(=O)N5C4)n4ccnc(N)c34)cc2)n1 |
| InChI | InChI=1S/C24H24N8O2S/c1-13-27-24(35-30-13)29-23(34)15-4-2-14(3-5-15)19-20-21(25)26-10-11-31(20)22(28-19)16-6-7-17-8-9-18(33)32(17)12-16/h2-5,10-11,16-17H,6-9,12H2,1H3,(H2,25,26)(H,27,29,30,34)/t16-,17+/m1/s1 |
| InChIKey | RBGSEXZXEIUEEB-SJORKVTESA-N |
| XLogP | 3.26 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |