C25H24FN3O5 — CID 76900721
4-[2-[(3R,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-5-fluoro-2-methoxybenzonitrile (PubChem CID 76900721) has the molecular formula C25H24FN3O5 and a molecular weight of 465.48 g/mol. Its IUPAC name is 4-[2-[(3R,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-5-fluoro-2-methoxybenzonitrile.
| Compound Name | 4-[2-[(3R,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-5-fluoro-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 76900721 |
| Molecular Formula | C25H24FN3O5 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-[2-[(3R,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-5-fluoro-2-methoxybenzonitrile |
| SMILES | COc1cc(CC(=O)N2CCN3C[C@@H](c4ccc5c(c4)COC5=O)OC[C@@H]3C2)c(F)cc1C#N |
| InChI | InChI=1S/C25H24FN3O5/c1-32-22-8-16(21(26)7-17(22)10-27)9-24(30)29-5-4-28-12-23(33-14-19(28)11-29)15-2-3-20-18(6-15)13-34-25(20)31/h2-3,6-8,19,23H,4-5,9,11-14H2,1H3/t19-,23-/m0/s1 |
| InChIKey | PBWVSJISMRJUGQ-CVDCTZTESA-N |
| XLogP | 2.20 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |