C13H21BrO2 — CID 7690097
(7R,11S)-3-(bromomethyl)-7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-ene (PubChem CID 7690097) has the molecular formula C13H21BrO2 and a molecular weight of 289.21 g/mol. Its IUPAC name is (7R,11S)-3-(bromomethyl)-7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-ene.
| Compound Name | (7R,11S)-3-(bromomethyl)-7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-ene |
|---|---|
| PubChem CID | 7690097 |
| Molecular Formula | C13H21BrO2 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (7R,11S)-3-(bromomethyl)-7,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-9-ene |
| SMILES | CC1=C[C@H](C)C2(COC(CBr)OC2)[C@H](C)C1 |
| InChI | InChI=1S/C13H21BrO2/c1-9-4-10(2)13(11(3)5-9)7-15-12(6-14)16-8-13/h4,10-12H,5-8H2,1-3H3/t10-,11+,12?,13?/m0/s1 |
| InChIKey | QHTOBVTUAAGHMD-ZFDZMSFRSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|