About 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile
2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile (PubChem CID 76901094) has the molecular formula C25H27N5O3
and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile.
Molecular Properties
| Compound Name | 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile |
| PubChem CID | 76901094 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile |
| SMILES | COc1ccc(N2CCN(c3nc(C4CC4)nc4cc(OC)c(OC)cc34)CC2)c(C#N)c1 |
| InChI | InChI=1S/C25H27N5O3/c1-31-18-6-7-21(17(12-18)15-26)29-8-10-30(11-9-29)25-19-13-22(32-2)23(33-3)14-20(19)27-24(28-25)16-4-5-16/h6-7,12-14,16H,4-5,8-11H2,1-3H3 |
| InChIKey | IFWDNQLVFWFJLO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile?
The IUPAC name of 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile (CID 76901094) is 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile.
What is the SMILES notation for 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile?
The canonical SMILES for 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile is COc1ccc(N2CCN(c3nc(C4CC4)nc4cc(OC)c(OC)cc34)CC2)c(C#N)c1.
What is the InChIKey of 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile?
The InChIKey is IFWDNQLVFWFJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N5O3/c1-31-18-6-7-21(17(12-18)15-26)29-8-10-30(11-9-29)25-19-13-22(32-2)23(33-3)14-20(19)27-24(28-25)16-4-5-16/h6-7,12-14,16H,4-5,8-11H2,1-3H3.
What are the key properties of 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile?
2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile has a molecular weight of 445.52 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-cyclopropyl-6,7-dimethoxyquinazolin-4-yl)piperazin-1-yl]-5-methoxybenzonitrile is sourced from PubChem (CID 76901094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).