C25H24FN3O4 — CID 76901100
3-[(3R,9aS)-8-[2-(1-oxo-3H-2-benzofuran-5-yl)acetyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-6-fluoro-2-methylbenzonitrile (PubChem CID 76901100) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is 3-[(3R,9aS)-8-[2-(1-oxo-3H-2-benzofuran-5-yl)acetyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-6-fluoro-2-methylbenzonitrile.
| Compound Name | 3-[(3R,9aS)-8-[2-(1-oxo-3H-2-benzofuran-5-yl)acetyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-6-fluoro-2-methylbenzonitrile |
|---|---|
| PubChem CID | 76901100 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 3-[(3R,9aS)-8-[2-(1-oxo-3H-2-benzofuran-5-yl)acetyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl]-6-fluoro-2-methylbenzonitrile |
| SMILES | Cc1c([C@@H]2CN3CCN(C(=O)Cc4ccc5c(c4)COC5=O)C[C@H]3CO2)ccc(F)c1C#N |
| InChI | InChI=1S/C25H24FN3O4/c1-15-19(4-5-22(26)21(15)10-27)23-12-28-6-7-29(11-18(28)14-32-23)24(30)9-16-2-3-20-17(8-16)13-33-25(20)31/h2-5,8,18,23H,6-7,9,11-14H2,1H3/t18-,23-/m0/s1 |
| InChIKey | XSXKOPCJHSZPIS-MBSDFSHPSA-N |
| XLogP | 2.50 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |