About 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide
5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide (PubChem CID 76901403) has the molecular formula C9H13N5OS
and a molecular weight of 239.30 g/mol. Its IUPAC name is 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide.
Molecular Properties
| Compound Name | 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide |
| PubChem CID | 76901403 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide |
| SMILES | CSc1nnc(C(N)=O)c(NC2CCC2)n1 |
| InChI | InChI=1S/C9H13N5OS/c1-16-9-12-8(11-5-3-2-4-5)6(7(10)15)13-14-9/h5H,2-4H2,1H3,(H2,10,15)(H,11,12,14) |
| InChIKey | WTXDSBSOZWEFDL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide?
The IUPAC name of 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide (CID 76901403) is 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide.
What is the SMILES notation for 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide?
The canonical SMILES for 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide is CSc1nnc(C(N)=O)c(NC2CCC2)n1.
What is the InChIKey of 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide?
The InChIKey is WTXDSBSOZWEFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5OS/c1-16-9-12-8(11-5-3-2-4-5)6(7(10)15)13-14-9/h5H,2-4H2,1H3,(H2,10,15)(H,11,12,14).
What are the key properties of 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide?
5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide has a molecular weight of 239.30 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclobutylamino)-3-methylsulfanyl-1,2,4-triazine-6-carboxamide is sourced from PubChem (CID 76901403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).