C28H27ClN4O3 — CID 76901577
(17S)-N-(4-chlorophenyl)-N-methyl-10,15-dioxo-6,11,16-triazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7(12),8,19,21-hexaene-17-carboxamide (PubChem CID 76901577) has the molecular formula C28H27ClN4O3 and a molecular weight of 503.00 g/mol. Its IUPAC name is (17S)-N-(4-chlorophenyl)-N-methyl-10,15-dioxo-6,11,16-triazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7(12),8,19,21-hexaene-17-carboxamide.
| Compound Name | (17S)-N-(4-chlorophenyl)-N-methyl-10,15-dioxo-6,11,16-triazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7(12),8,19,21-hexaene-17-carboxamide |
|---|---|
| PubChem CID | 76901577 |
| Molecular Formula | C28H27ClN4O3 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (17S)-N-(4-chlorophenyl)-N-methyl-10,15-dioxo-6,11,16-triazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7(12),8,19,21-hexaene-17-carboxamide |
| SMILES | CN(C(=O)[C@@H]1Cc2cccc(c2)CCCc2[nH]c3ccc(=O)[nH]c3c2CC(=O)N1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H27ClN4O3/c1-33(20-10-8-19(29)9-11-20)28(36)24-15-18-6-2-4-17(14-18)5-3-7-22-21(16-26(35)31-24)27-23(30-22)12-13-25(34)32-27/h2,4,6,8-14,24,30H,3,5,7,15-16H2,1H3,(H,31,35)(H,32,34)/t24-/m0/s1 |
| InChIKey | DHWCRZNPYLNFPR-DEOSSOPVSA-N |
| XLogP | 3.93 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |