C17H22FN3O5S — CID 76901922
N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxyacetamide (PubChem CID 76901922) has the molecular formula C17H22FN3O5S and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxyacetamide.
| Compound Name | N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 76901922 |
| Molecular Formula | C17H22FN3O5S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(F)c([C@]23COC[C@H]2S(=O)(=O)C(C)(C)C(N)=N3)c1 |
| InChI | InChI=1S/C17H22FN3O5S/c1-16(2)15(19)21-17(9-26-7-13(17)27(16,23)24)11-6-10(4-5-12(11)18)20-14(22)8-25-3/h4-6,13H,7-9H2,1-3H3,(H2,19,21)(H,20,22)/t13-,17-/m1/s1 |
| InChIKey | ODFHWGXAJALDTE-CXAGYDPISA-N |
| XLogP | 0.57 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |