C18H24FN3O5S — CID 76901924
(2R)-N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxypropanamide (PubChem CID 76901924) has the molecular formula C18H24FN3O5S and a molecular weight of 413.47 g/mol. Its IUPAC name is (2R)-N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxypropanamide.
| Compound Name | (2R)-N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 76901924 |
| Molecular Formula | C18H24FN3O5S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (2R)-N-[3-[(4aS,7aS)-3-amino-2,2-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-b][1,4]thiazin-4a-yl]-4-fluorophenyl]-2-methoxypropanamide |
| SMILES | CO[C@H](C)C(=O)Nc1ccc(F)c([C@]23COC[C@H]2S(=O)(=O)C(C)(C)C(N)=N3)c1 |
| InChI | InChI=1S/C18H24FN3O5S/c1-10(26-4)15(23)21-11-5-6-13(19)12(7-11)18-9-27-8-14(18)28(24,25)17(2,3)16(20)22-18/h5-7,10,14H,8-9H2,1-4H3,(H2,20,22)(H,21,23)/t10-,14-,18-/m1/s1 |
| InChIKey | HDZXDROMEIJJHI-MAZCYNQFSA-N |
| XLogP | 0.96 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |