C29H31N7O3 — CID 76901986
4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-[4-(1-methoxyethyl)-2-pyridinyl]benzamide (PubChem CID 76901986) has the molecular formula C29H31N7O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-[4-(1-methoxyethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-[4-(1-methoxyethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 76901986 |
| Molecular Formula | C29H31N7O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-N-[4-(1-methoxyethyl)-2-pyridinyl]benzamide |
| SMILES | COC(C)c1ccnc(NC(=O)c2ccc(-c3nc([C@@H]4CC[C@H]5CCC(=O)N5C4)n4ccnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C29H31N7O3/c1-17(39-2)20-11-12-31-23(15-20)33-29(38)19-5-3-18(4-6-19)25-26-27(30)32-13-14-35(26)28(34-25)21-7-8-22-9-10-24(37)36(22)16-21/h3-6,11-15,17,21-22H,7-10,16H2,1-2H3,(H2,30,32)(H,31,33,38)/t17?,21-,22+/m1/s1 |
| InChIKey | PXWFTQSGNDTSMO-RRNUJPESSA-N |
| XLogP | 4.20 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |