C20H30BN3O7S — CID 76902496
(3R)-2-hydroxy-3-[[2-[4-[2-(methanesulfonamido)ethylamino]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 76902496) has the molecular formula C20H30BN3O7S and a molecular weight of 467.35 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[[2-[4-[2-(methanesulfonamido)ethylamino]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[[2-[4-[2-(methanesulfonamido)ethylamino]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 76902496 |
| Molecular Formula | C20H30BN3O7S |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (3R)-2-hydroxy-3-[[2-[4-[2-(methanesulfonamido)ethylamino]cyclohexyl]acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CS(=O)(=O)NCCNC1CCC(CC(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1 |
| InChI | InChI=1S/C20H30BN3O7S/c1-32(29,30)23-10-9-22-15-7-5-13(6-8-15)11-18(25)24-17-12-14-3-2-4-16(20(26)27)19(14)31-21(17)28/h2-4,13,15,17,22-23,28H,5-12H2,1H3,(H,24,25)(H,26,27)/t13?,15?,17-/m0/s1 |
| InChIKey | FDTPBDPLSZSCCR-PGEKIEPBSA-N |
| XLogP | -0.09 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|