About 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline
4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline (PubChem CID 76902614) has the molecular formula C23H24ClN5O4
and a molecular weight of 469.93 g/mol. Its IUPAC name is 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline.
Molecular Properties
| Compound Name | 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline |
| PubChem CID | 76902614 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2nc(C3CC3)nc(N3CCN(c4ccc([N+](=O)[O-])cc4Cl)CC3)c2cc1OC |
| InChI | InChI=1S/C23H24ClN5O4/c1-32-20-12-16-18(13-21(20)33-2)25-22(14-3-4-14)26-23(16)28-9-7-27(8-10-28)19-6-5-15(29(30)31)11-17(19)24/h5-6,11-14H,3-4,7-10H2,1-2H3 |
| InChIKey | JGPZWZBSUPPTRX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline?
The IUPAC name of 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline (CID 76902614) is 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline.
What is the SMILES notation for 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline?
The canonical SMILES for 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline is COc1cc2nc(C3CC3)nc(N3CCN(c4ccc([N+](=O)[O-])cc4Cl)CC3)c2cc1OC.
What is the InChIKey of 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline?
The InChIKey is JGPZWZBSUPPTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClN5O4/c1-32-20-12-16-18(13-21(20)33-2)25-22(14-3-4-14)26-23(16)28-9-7-27(8-10-28)19-6-5-15(29(30)31)11-17(19)24/h5-6,11-14H,3-4,7-10H2,1-2H3.
What are the key properties of 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline?
4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline has a molecular weight of 469.93 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-2-cyclopropyl-6,7-dimethoxyquinazoline is sourced from PubChem (CID 76902614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).