About (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol
(3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol (PubChem CID 76902730) has the molecular formula C17H14ClF3N2O
and a molecular weight of 354.76 g/mol. Its IUPAC name is (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol.
Molecular Properties
| Compound Name | (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol |
| PubChem CID | 76902730 |
| Molecular Formula | C17H14ClF3N2O |
| Molecular Weight | 354.76 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol |
| SMILES | O[C@@H]1CNCC(F)(F)[C@H]1n1c2ccc(F)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H14ClF3N2O/c18-9-1-3-13-11(5-9)12-6-10(19)2-4-14(12)23(13)16-15(24)7-22-8-17(16,20)21/h1-6,15-16,22,24H,7-8H2/t15-,16+/m1/s1 |
| InChIKey | VYMVSRQUJNRLPF-CVEARBPZSA-N |
| XLogP | 3.73 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol?
The IUPAC name of (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol (CID 76902730) is (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol.
What is the SMILES notation for (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol?
The canonical SMILES for (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol is O[C@@H]1CNCC(F)(F)[C@H]1n1c2ccc(F)cc2c2cc(Cl)ccc21.
What is the InChIKey of (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol?
The InChIKey is VYMVSRQUJNRLPF-CVEARBPZSA-N. The full InChI is InChI=1S/C17H14ClF3N2O/c18-9-1-3-13-11(5-9)12-6-10(19)2-4-14(12)23(13)16-15(24)7-22-8-17(16,20)21/h1-6,15-16,22,24H,7-8H2/t15-,16+/m1/s1.
What are the key properties of (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol?
(3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol has a molecular weight of 354.76 g/mol, XLogP of 3.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(3-chloro-6-fluorocarbazol-9-yl)-5,5-difluoropiperidin-3-ol is sourced from PubChem (CID 76902730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).