C23H16BrCl3F6N2O2 — CID 76902990
2-bromo-N-[3-oxo-3-(1,1,1-trifluoropropan-2-ylamino)prop-1-en-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 76902990) has the molecular formula C23H16BrCl3F6N2O2 and a molecular weight of 652.64 g/mol. Its IUPAC name is 2-bromo-N-[3-oxo-3-(1,1,1-trifluoropropan-2-ylamino)prop-1-en-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[3-oxo-3-(1,1,1-trifluoropropan-2-ylamino)prop-1-en-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 76902990 |
| Molecular Formula | C23H16BrCl3F6N2O2 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 649.94 |
| IUPAC Name | 2-bromo-N-[3-oxo-3-(1,1,1-trifluoropropan-2-ylamino)prop-1-en-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C=C(NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Br)C(=O)NC(C)C(F)(F)F |
| InChI | InChI=1S/C23H16BrCl3F6N2O2/c1-10(20(36)35-11(2)22(28,29)30)34-21(37)14-5-3-12(7-16(14)24)4-6-15(23(31,32)33)13-8-17(25)19(27)18(26)9-13/h3-9,11,15H,1H2,2H3,(H,34,37)(H,35,36)/b6-4+ |
| InChIKey | ZOBALYOKRHZLIV-GQCTYLIASA-N |
| XLogP | 8.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|