C25H30N2O5S — CID 76903093
3-(cyclopropylmethoxy)-N-[2-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]propan-2-yl]benzenesulfonamide (PubChem CID 76903093) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-[2-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]propan-2-yl]benzenesulfonamide.
| Compound Name | 3-(cyclopropylmethoxy)-N-[2-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 76903093 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-[2-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]propan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(NS(=O)(=O)c1cccc(OCC2CC2)c1)c1ccc(CC2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C25H30N2O5S/c1-25(2,20-11-8-17(9-12-20)14-19-10-13-23(28)26-24(19)29)27-33(30,31)22-5-3-4-21(15-22)32-16-18-6-7-18/h3-5,8-9,11-12,15,18-19,27H,6-7,10,13-14,16H2,1-2H3,(H,26,28,29) |
| InChIKey | YYOGKLQWHRNRRN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|