C23H19Cl2N5O — CID 76903144
5-[4-[3-[2-(2,5-dichlorophenyl)ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]pyrazol-1-yl]piperidin-3-ol (PubChem CID 76903144) has the molecular formula C23H19Cl2N5O and a molecular weight of 452.35 g/mol. Its IUPAC name is 5-[4-[3-[2-(2,5-dichlorophenyl)ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]pyrazol-1-yl]piperidin-3-ol.
| Compound Name | 5-[4-[3-[2-(2,5-dichlorophenyl)ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]pyrazol-1-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 76903144 |
| Molecular Formula | C23H19Cl2N5O |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 5-[4-[3-[2-(2,5-dichlorophenyl)ethynyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]pyrazol-1-yl]piperidin-3-ol |
| SMILES | OC1CNCC(n2cc(-c3cnc4[nH]cc(C#Cc5cc(Cl)ccc5Cl)c4c3)cn2)C1 |
| InChI | InChI=1S/C23H19Cl2N5O/c24-18-3-4-22(25)14(5-18)1-2-15-8-27-23-21(15)6-16(9-28-23)17-10-29-30(13-17)19-7-20(31)12-26-11-19/h3-6,8-10,13,19-20,26,31H,7,11-12H2,(H,27,28) |
| InChIKey | GQWGULZFNZWVSY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|