C17H16ClNO2 — CID 76903787
3-[2-[(2-chlorophenyl)methyl-methylamino]phenyl]prop-2-enoic acid (PubChem CID 76903787) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is 3-[2-[(2-chlorophenyl)methyl-methylamino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[(2-chlorophenyl)methyl-methylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76903787 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-[2-[(2-chlorophenyl)methyl-methylamino]phenyl]prop-2-enoic acid |
| SMILES | CN(Cc1ccccc1Cl)c1ccccc1C=CC(=O)O |
| InChI | InChI=1S/C17H16ClNO2/c1-19(12-14-7-2-4-8-15(14)18)16-9-5-3-6-13(16)10-11-17(20)21/h2-11H,12H2,1H3,(H,20,21) |
| InChIKey | GZQMTNOZBXWLDL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|