About 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide
4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide (PubChem CID 76904459) has the molecular formula C13H28N4O3S
and a molecular weight of 320.46 g/mol. Its IUPAC name is 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide.
Molecular Properties
| Compound Name | 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide |
| PubChem CID | 76904459 |
| Molecular Formula | C13H28N4O3S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide |
| SMILES | CCC1CCC(NS(=O)(=O)N(C)C(C)C)(C(N)=NO)CC1 |
| InChI | InChI=1S/C13H28N4O3S/c1-5-11-6-8-13(9-7-11,12(14)15-18)16-21(19,20)17(4)10(2)3/h10-11,16,18H,5-9H2,1-4H3,(H2,14,15) |
| InChIKey | ZTGFSQLFXZXOQI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide?
The IUPAC name of 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide (CID 76904459) is 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide.
What is the SMILES notation for 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide?
The canonical SMILES for 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide is CCC1CCC(NS(=O)(=O)N(C)C(C)C)(C(N)=NO)CC1.
What is the InChIKey of 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide?
The InChIKey is ZTGFSQLFXZXOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N4O3S/c1-5-11-6-8-13(9-7-11,12(14)15-18)16-21(19,20)17(4)10(2)3/h10-11,16,18H,5-9H2,1-4H3,(H2,14,15).
What are the key properties of 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide?
4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide has a molecular weight of 320.46 g/mol, XLogP of 1.25, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N'-hydroxy-1-[[methyl(propan-2-yl)sulfamoyl]amino]cyclohexane-1-carboximidamide is sourced from PubChem (CID 76904459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).