C14H16N2O4S — CID 76906643
3-[2-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 76906643) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[2-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906643 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[2-(3,3-diethyl-2,5-dioxopyrrolidin-1-yl)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CCC1(CC)CC(=O)N(c2ncc(C=CC(=O)O)s2)C1=O |
| InChI | InChI=1S/C14H16N2O4S/c1-3-14(4-2)7-10(17)16(12(14)20)13-15-8-9(21-13)5-6-11(18)19/h5-6,8H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | WHLDVLUJZPROSF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|