C14H15N3O3S — CID 76907215
3-[5-(1-pyrazol-1-ylpropan-2-ylcarbamoyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 76907215) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[5-(1-pyrazol-1-ylpropan-2-ylcarbamoyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(1-pyrazol-1-ylpropan-2-ylcarbamoyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907215 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[5-(1-pyrazol-1-ylpropan-2-ylcarbamoyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | CC(Cn1cccn1)NC(=O)c1ccc(C=CC(=O)O)s1 |
| InChI | InChI=1S/C14H15N3O3S/c1-10(9-17-8-2-7-15-17)16-14(20)12-5-3-11(21-12)4-6-13(18)19/h2-8,10H,9H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | BCEAMFXXZOGUAI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|