C17H25NO3 — CID 76908294
3-[3-[2-[methyl(3-methylbutan-2-yl)amino]ethoxy]phenyl]prop-2-enoic acid (PubChem CID 76908294) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-[3-[2-[methyl(3-methylbutan-2-yl)amino]ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-[methyl(3-methylbutan-2-yl)amino]ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76908294 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-[3-[2-[methyl(3-methylbutan-2-yl)amino]ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CC(C)C(C)N(C)CCOc1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C17H25NO3/c1-13(2)14(3)18(4)10-11-21-16-7-5-6-15(12-16)8-9-17(19)20/h5-9,12-14H,10-11H2,1-4H3,(H,19,20) |
| InChIKey | OJYQLDMKDNWSSO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|