About 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea
1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea (PubChem CID 76911535) has the molecular formula C10H22N4O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea |
| PubChem CID | 76911535 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea |
| SMILES | CC(C)NC(=O)N(CCC(N)=NO)C(C)C |
| InChI | InChI=1S/C10H22N4O2/c1-7(2)12-10(15)14(8(3)4)6-5-9(11)13-16/h7-8,16H,5-6H2,1-4H3,(H2,11,13)(H,12,15) |
| InChIKey | MYNISBZOVJCYSK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea?
The IUPAC name of 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea (CID 76911535) is 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea.
What is the SMILES notation for 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea?
The canonical SMILES for 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea is CC(C)NC(=O)N(CCC(N)=NO)C(C)C.
What is the InChIKey of 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea?
The InChIKey is MYNISBZOVJCYSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O2/c1-7(2)12-10(15)14(8(3)4)6-5-9(11)13-16/h7-8,16H,5-6H2,1-4H3,(H2,11,13)(H,12,15).
What are the key properties of 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea?
1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea has a molecular weight of 230.31 g/mol, XLogP of 0.95, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-3-hydroxyiminopropyl)-1,3-di(propan-2-yl)urea is sourced from PubChem (CID 76911535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).