About 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide
3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 76911842) has the molecular formula C8H15F2N3O
and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide |
| PubChem CID | 76911842 |
| Molecular Formula | C8H15F2N3O |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | NC(CCN(CC(F)F)C1CC1)=NO |
| InChI | InChI=1S/C8H15F2N3O/c9-7(10)5-13(6-1-2-6)4-3-8(11)12-14/h6-7,14H,1-5H2,(H2,11,12) |
| InChIKey | NTXSZDYKVDPXLW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide?
The IUPAC name of 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide (CID 76911842) is 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide?
The canonical SMILES for 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide is NC(CCN(CC(F)F)C1CC1)=NO.
What is the InChIKey of 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide?
The InChIKey is NTXSZDYKVDPXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2N3O/c9-7(10)5-13(6-1-2-6)4-3-8(11)12-14/h6-7,14H,1-5H2,(H2,11,12).
What are the key properties of 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide?
3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide has a molecular weight of 207.22 g/mol, XLogP of 0.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(2,2-difluoroethyl)amino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 76911842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).