C13H18F3N3O — CID 76912554
N'-hydroxy-3-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide (PubChem CID 76912554) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is N'-hydroxy-3-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 76912554 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N'-hydroxy-3-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]benzenecarboximidamide |
| SMILES | CC(C)N(Cc1cccc(C(N)=NO)c1)CC(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O/c1-9(2)19(8-13(14,15)16)7-10-4-3-5-11(6-10)12(17)18-20/h3-6,9,20H,7-8H2,1-2H3,(H2,17,18) |
| InChIKey | CMYUOSWNRARFNE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|