C16H21NO4 — CID 76912754
3-[4-[ethyl(1-methoxypropan-2-yl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 76912754) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[4-[ethyl(1-methoxypropan-2-yl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[ethyl(1-methoxypropan-2-yl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76912754 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-[4-[ethyl(1-methoxypropan-2-yl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | CCN(C(=O)c1ccc(C=CC(=O)O)cc1)C(C)COC |
| InChI | InChI=1S/C16H21NO4/c1-4-17(12(2)11-21-3)16(20)14-8-5-13(6-9-14)7-10-15(18)19/h5-10,12H,4,11H2,1-3H3,(H,18,19) |
| InChIKey | QUVQKHFFQBDNBC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|