C14H16ClNO4 — CID 76914634
3-[3-chloro-4-[1-(ethylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 76914634) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 3-[3-chloro-4-[1-(ethylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-chloro-4-[1-(ethylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76914634 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-[3-chloro-4-[1-(ethylamino)-1-oxopropan-2-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | CCNC(=O)C(C)Oc1ccc(C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4/c1-3-16-14(19)9(2)20-12-6-4-10(8-11(12)15)5-7-13(17)18/h4-9H,3H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | OOPGGCNCNIDNAM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|