About 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide
2-(2-ethylphenoxy)-N'-hydroxypropanimidamide (PubChem CID 76915107) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide |
| PubChem CID | 76915107 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide |
| SMILES | CCc1ccccc1OC(C)C(N)=NO |
| InChI | InChI=1S/C11H16N2O2/c1-3-9-6-4-5-7-10(9)15-8(2)11(12)13-14/h4-8,14H,3H2,1-2H3,(H2,12,13) |
| InChIKey | AAVAWDKCCZBRDG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide?
The IUPAC name of 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide (CID 76915107) is 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide?
The canonical SMILES for 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide is CCc1ccccc1OC(C)C(N)=NO.
What is the InChIKey of 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide?
The InChIKey is AAVAWDKCCZBRDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-3-9-6-4-5-7-10(9)15-8(2)11(12)13-14/h4-8,14H,3H2,1-2H3,(H2,12,13).
What are the key properties of 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide?
2-(2-ethylphenoxy)-N'-hydroxypropanimidamide has a molecular weight of 208.26 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylphenoxy)-N'-hydroxypropanimidamide is sourced from PubChem (CID 76915107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).