About 2-(dimethylamino)-N'-hydroxypropanimidamide
2-(dimethylamino)-N'-hydroxypropanimidamide (PubChem CID 76915189) has the molecular formula C5H13N3O
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-(dimethylamino)-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N'-hydroxypropanimidamide |
|---|
| PubChem CID | 76915189 |
|---|
| Molecular Formula | C5H13N3O |
|---|
| Molecular Weight | 131.18 g/mol |
|---|
| Exact Mass | 131.11 |
|---|
| IUPAC Name | 2-(dimethylamino)-N'-hydroxypropanimidamide |
|---|
| SMILES | CC(C(N)=NO)N(C)C |
|---|
| InChI | InChI=1S/C5H13N3O/c1-4(8(2)3)5(6)7-9/h4,9H,1-3H3,(H2,6,7) |
|---|
| InChIKey | JAPZVNKSUSWNSN-UHFFFAOYSA-N |
|---|
| XLogP | -0.32 |
|---|
| TPSA | 61.85 Ų |
|---|
| H-Bond Donors | 2 |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N'-hydroxypropanimidamide?
The IUPAC name of 2-(dimethylamino)-N'-hydroxypropanimidamide (CID 76915189) is 2-(dimethylamino)-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-(dimethylamino)-N'-hydroxypropanimidamide?
The canonical SMILES for 2-(dimethylamino)-N'-hydroxypropanimidamide is CC(C(N)=NO)N(C)C.
What is the InChIKey of 2-(dimethylamino)-N'-hydroxypropanimidamide?
The InChIKey is JAPZVNKSUSWNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O/c1-4(8(2)3)5(6)7-9/h4,9H,1-3H3,(H2,6,7).
What are the key properties of 2-(dimethylamino)-N'-hydroxypropanimidamide?
2-(dimethylamino)-N'-hydroxypropanimidamide has a molecular weight of 131.18 g/mol, XLogP of -0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N'-hydroxypropanimidamide is sourced from PubChem (CID 76915189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).